Products 88755-16-2

CAS 88755-16-2 appears in our catalog under these names: 2–Oxo–2–(3,4,5–trimethoxyphenyl)acetic acid, 2-Oxo-2-(3,4,5-trimethoxyphenyl)acetic acid 95%, 3,4,5-Trimethoxy-a-oxo-benzeneacetic acid, 97%, 97%, Oxo(3,4,5-trimethoxyphenyl)acetic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-oxo-2-(3,4,5-trimethoxyphenyl)acetic acid (CAS 88755-16-2) is a chemical compound with the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. IUPAC name: 2-oxo-2-(3,4,5-trimethoxyphenyl)acetic acid. InChIKey: LADJHQSUVNTXES-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O6
Molecular weight240.21 g/mol
IUPAC name2-oxo-2-(3,4,5-trimethoxyphenyl)acetic acid
InChIKeyLADJHQSUVNTXES-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C(=O)C(=O)O

Computed by PubChem (NCBI)