CAS 3809-00-5 appears in our catalog under these names: 2-(Carboxymethyl)-4,5-dimethoxybenzoic acid, 98%, 2-(carboxymethyl)-4,5-dimethoxybenzoic acid, 95+%, 2–(carboxymethyl)–4,5–dimethoxybenzoic acid, 2-(Carboxymethyl)-4,5-dimethoxybenzoic acid, 2-(carboxymethyl)-4,5-dimethoxybenzoic acid 95+%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 500mg.
2-(carboxymethyl)-4,5-dimethoxybenzoic acid (CAS 3809-00-5) is a chemical compound with the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. IUPAC name: 2-(carboxymethyl)-4,5-dimethoxybenzoic acid. InChIKey: NOUUHGZLGUYQON-UHFFFAOYSA-N.
| Molecular formula | C11H12O6 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-(carboxymethyl)-4,5-dimethoxybenzoic acid |
| InChIKey | NOUUHGZLGUYQON-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)O)C(=O)O)OC |
Computed by PubChem (NCBI)