Products 95046-98-3

CAS 95046-98-3 is the registry number for 4-Carboxymethoxy-3-methoxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

2-(2-methoxy-4-methoxycarbonylphenoxy)acetic acid (CAS 95046-98-3) is a chemical compound with the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. IUPAC name: 2-(2-methoxy-4-methoxycarbonylphenoxy)acetic acid. InChIKey: KNECNYNCUWLYSU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O6
Molecular weight240.21 g/mol
IUPAC name2-(2-methoxy-4-methoxycarbonylphenoxy)acetic acid
InChIKeyKNECNYNCUWLYSU-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C(=O)OC)OCC(=O)O

Computed by PubChem (NCBI)