Products 1246814-80-1
CAS 1246814-80-1 appears in our catalog under these names: 4-Hydroxy-3-methoxy Methamphetamine-d3 Hydrochloride, 4-Hydroxy-3-methoxy methamphetamine-d3 hydrochloride - controlled substance. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
2-methoxy-4-[2-(trideuteriomethylamino)propyl]phenol;hydrochloride (CAS 1246814-80-1) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 234.74 g/mol. IUPAC name: 2-methoxy-4-[2-(trideuteriomethylamino)propyl]phenol;hydrochloride. InChIKey: LDRJCJMDWCULLX-MUTAZJQDSA-N.
| Molecular formula | C11H18ClNO2 |
|---|---|
| Molecular weight | 234.74 g/mol |
| IUPAC name | 2-methoxy-4-[2-(trideuteriomethylamino)propyl]phenol;hydrochloride |
| InChIKey | LDRJCJMDWCULLX-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)CC1=CC(=C(C=C1)O)OC.Cl |
Computed by PubChem (NCBI)