CAS 438625-58-2 appears in our catalog under these names: 4-Hydroxy-3-methoxy Methamphetamine Hydrochloride, 4-Hydroxy-3-methoxy Methamphetamine Hydrochloride (1.0 mg/ml in Methanol), d,l-HMMA.HCl, d,l-HMMA.HCl, 1mg/ml in Methanol (as free base), HMMA (hydrochloride). Offered by: TRC, Lipomed, GLPBio. Available pack sizes: 10mg, 2,5mg, 25mg, 1x1ml, 50mg, 100mg, 1ml, 1mg.
2-methoxy-4-[2-(methylamino)propyl]phenol;hydrochloride (CAS 438625-58-2) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. IUPAC name: 2-methoxy-4-[2-(methylamino)propyl]phenol;hydrochloride. InChIKey: LDRJCJMDWCULLX-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO2 |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 2-methoxy-4-[2-(methylamino)propyl]phenol;hydrochloride |
| InChIKey | LDRJCJMDWCULLX-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)O)OC)NC.Cl |
Computed by PubChem (NCBI)