Products 1246815-25-7
CAS 1246815-25-7 appears in our catalog under these names: 6-Demethyl Papaverine-d3 (1mg/ml in Acetonitrile), 6-Demethyl Papaverine-d3. Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 1mg.
1-[(3,4-dimethoxyphenyl)methyl]-7-(trideuteriomethoxy)isoquinolin-6-ol (CAS 1246815-25-7) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 328.4 g/mol. IUPAC name: 1-[(3,4-dimethoxyphenyl)methyl]-7-(trideuteriomethoxy)isoquinolin-6-ol. InChIKey: BFMUDRSIIFRJOG-BMSJAHLVSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 1-[(3,4-dimethoxyphenyl)methyl]-7-(trideuteriomethoxy)isoquinolin-6-ol |
| InChIKey | BFMUDRSIIFRJOG-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C2C=CN=C(C2=C1)CC3=CC(=C(C=C3)OC)OC)O |
Computed by PubChem (NCBI)