Products 1246815-39-3
CAS 1246815-39-3 is the registry number for Methyl 6-Methoxy-2-naphthylacetate-d6. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Trideuteriomethyl 2-[6-(trideuteriomethoxy)naphthalen-2-yl]acetate (CAS 1246815-39-3) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 236.30 g/mol. IUPAC name: trideuteriomethyl 2-[6-(trideuteriomethoxy)naphthalen-2-yl]acetate. InChIKey: NWIMPGMAVYLECN-WFGJKAKNSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 236.30 g/mol |
| IUPAC name | trideuteriomethyl 2-[6-(trideuteriomethoxy)naphthalen-2-yl]acetate |
| InChIKey | NWIMPGMAVYLECN-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C=C(C=C2)CC(=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)