Products 23981-48-8

CAS 23981-48-8 is the registry number for Methyl 6-Methoxy-2-naphthylacetate. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

Methyl 2-(6-methoxynaphthalen-2-yl)acetate (CAS 23981-48-8) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: methyl 2-(6-methoxynaphthalen-2-yl)acetate. InChIKey: NWIMPGMAVYLECN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O3
Molecular weight230.26 g/mol
IUPAC namemethyl 2-(6-methoxynaphthalen-2-yl)acetate
InChIKeyNWIMPGMAVYLECN-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C=C(C=C2)CC(=O)OC

Computed by PubChem (NCBI)