Products 1246816-53-4
CAS 1246816-53-4 appears in our catalog under these names: 3-Methoxy Acetaminophen-d3, >95% (HPLC), 3-Methoxyacetaminophen-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 50mg, 25 mg, 2.5 mg, 50 mg.
2,2,2-trideuterio-N-(4-hydroxy-3-methoxyphenyl)acetamide (CAS 1246816-53-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 184.21 g/mol. IUPAC name: 2,2,2-trideuterio-N-(4-hydroxy-3-methoxyphenyl)acetamide. InChIKey: KIZWIAQUWRXFNC-FIBGUPNXSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 184.21 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(4-hydroxy-3-methoxyphenyl)acetamide |
| InChIKey | KIZWIAQUWRXFNC-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=CC(=C(C=C1)O)OC |
Computed by PubChem (NCBI)