CAS 1246817-03-7 is the registry number for 2-Chloro-4-piperazin-1-ylphenol-d8. Offered by: TRC. Available pack sizes: 25mg.
2-chloro-4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)phenol (CAS 1246817-03-7) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 220.72 g/mol. IUPAC name: 2-chloro-4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)phenol. InChIKey: FXECOYYRPDGOQB-SQUIKQQTSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 220.72 g/mol |
| IUPAC name | 2-chloro-4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)phenol |
| InChIKey | FXECOYYRPDGOQB-SQUIKQQTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=CC(=C(C=C2)O)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)