CAS 85474-76-6 is the registry number for 2-Chloro-4-piperazin-1-ylphenol Dihydrochloride. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-chloro-4-piperazin-1-ylphenol (CAS 85474-76-6) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 2-chloro-4-piperazin-1-ylphenol. InChIKey: FXECOYYRPDGOQB-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 2-chloro-4-piperazin-1-ylphenol |
| InChIKey | FXECOYYRPDGOQB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)