Products 1246819-29-3
CAS 1246819-29-3 appears in our catalog under these names: Phenylephrone-d3 Hydrochloride, >95% (HPLC), Phenylephrone-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
1-(3-hydroxyphenyl)-2-(trideuteriomethylamino)ethanone;hydrochloride (CAS 1246819-29-3) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 204.67 g/mol. IUPAC name: 1-(3-hydroxyphenyl)-2-(trideuteriomethylamino)ethanone;hydrochloride. InChIKey: DEOGEZWYKPQJLP-NIIDSAIPSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | 1-(3-hydroxyphenyl)-2-(trideuteriomethylamino)ethanone;hydrochloride |
| InChIKey | DEOGEZWYKPQJLP-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCC(=O)C1=CC(=CC=C1)O.Cl |
Computed by PubChem (NCBI)