CAS 124707-92-2 is the registry number for 3,5,8-Trimethyl-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5,8-trimethylchromen-2-one (CAS 124707-92-2) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 3,5,8-trimethylchromen-2-one. InChIKey: WQINIDWRLXNROW-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 3,5,8-trimethylchromen-2-one |
| InChIKey | WQINIDWRLXNROW-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C(=O)OC2=C(C=C1)C)C |
Computed by PubChem (NCBI)