Products 1247118-11-1
CAS 1247118-11-1 appears in our catalog under these names: 3-(5-Methyl-1,3-thiazol-2-yl)benzoic acid, 3-(5-Methylthiazol-2-yl)benzoic acid, 95%, 95%, 3-(5-Methylthiazol-2-yl)benzoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3-(5-methyl-1,3-thiazol-2-yl)benzoic acid (CAS 1247118-11-1) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 3-(5-methyl-1,3-thiazol-2-yl)benzoic acid. InChIKey: ZVMVNRWWXZEPMS-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 3-(5-methyl-1,3-thiazol-2-yl)benzoic acid |
| InChIKey | ZVMVNRWWXZEPMS-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)