Products 1247184-71-9
CAS 1247184-71-9 appears in our catalog under these names: 4-(4-Bromophenyl)thiazol-5-amine, 97%, 4-(4-Bromophenyl)-1,3-thiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(4-bromophenyl)-1,3-thiazol-5-amine (CAS 1247184-71-9) is a chemical compound with the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. IUPAC name: 4-(4-bromophenyl)-1,3-thiazol-5-amine. InChIKey: FHSYNTBUANJWAO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2S |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1,3-thiazol-5-amine |
| InChIKey | FHSYNTBUANJWAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(SC=N2)N)Br |
Computed by PubChem (NCBI)