CAS 152191-42-9 is the registry number for (1S,2R,3R,8S)-4-(Morpholine-4-carbonyl)cubane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(morpholine-4-carbonyl)cubane-1-carboxylic acid (CAS 152191-42-9) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: 4-(morpholine-4-carbonyl)cubane-1-carboxylic acid. InChIKey: SHIBXKANMPGROO-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 4-(morpholine-4-carbonyl)cubane-1-carboxylic acid |
| InChIKey | SHIBXKANMPGROO-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C23C4C5C2C6C3C4C56C(=O)O |
Computed by PubChem (NCBI)