Products 1247612-70-9
CAS 1247612-70-9 is the registry number for 6-Oxo-1-(2,2,2-trifluoroethyl)-1,6-dihydropyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylic acid (CAS 1247612-70-9) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 6-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylic acid. InChIKey: ZZUYTXHBEZZMHR-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 6-oxo-1-(2,2,2-trifluoroethyl)pyridine-3-carboxylic acid |
| InChIKey | ZZUYTXHBEZZMHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1C(=O)O)CC(F)(F)F |
Computed by PubChem (NCBI)