CAS 1248541-72-1 appears in our catalog under these names: Methyl 2-amino-5-methyl-3-nitrobenzoate, 95+%, Methyl 2-amino-5-methyl-3-nitrobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 2g, 1g, 10g.
Methyl 2-amino-5-methyl-3-nitrobenzoate (CAS 1248541-72-1) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: methyl 2-amino-5-methyl-3-nitrobenzoate. InChIKey: BMVWWCPPMDIQTE-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | methyl 2-amino-5-methyl-3-nitrobenzoate |
| InChIKey | BMVWWCPPMDIQTE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])N)C(=O)OC |
Computed by PubChem (NCBI)