CAS 1248559-59-2 appears in our catalog under these names: 1-Ethyl-3,3,7-trimethyl-5-nitro-1,3-dihydro-2h-indol-2-one, 95%, 1-Ethyl-3,3,7-trimethyl-5-nitroindolin-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-ethyl-3,3,7-trimethyl-5-nitroindol-2-one (CAS 1248559-59-2) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: 1-ethyl-3,3,7-trimethyl-5-nitroindol-2-one. InChIKey: AXOWQJSPUAUQKT-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1-ethyl-3,3,7-trimethyl-5-nitroindol-2-one |
| InChIKey | AXOWQJSPUAUQKT-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2C)[N+](=O)[O-])C(C1=O)(C)C |
Computed by PubChem (NCBI)