CAS 124882-74-2 appears in our catalog under these names: Fa-gly-oh, 95%, FA-GLY-OH, >95% (HPLC), FA–Gly–OH, FA-Gly-OH, FA-Gly-OH, ≥95%, ≥95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 25mg, 50mg, 10g, 25g.
2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetic acid (CAS 124882-74-2) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetic acid. InChIKey: XJVSWKBQMAOKAX-ONEGZZNKSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetic acid |
| InChIKey | XJVSWKBQMAOKAX-ONEGZZNKSA-N |
| SMILES | C1=COC(=C1)/C=C/C(=O)NCC(=O)O |
Computed by PubChem (NCBI)