Products 1249033-96-2
CAS 1249033-96-2 is the registry number for 5-Methyl-2-(1-methyl-1H-pyrazol-4-yl)-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-4-carboxylic acid (CAS 1249033-96-2) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 5-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-4-carboxylic acid. InChIKey: JAZHJDWLDRGMBW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 5-methyl-2-(1-methylpyrazol-4-yl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | JAZHJDWLDRGMBW-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CN(N=C2)C)C(=O)O |
Computed by PubChem (NCBI)