Products 1249047-50-4
CAS 1249047-50-4 is the registry number for 4-(Butan-2-yloxy)-6-chloro-2-methylpyrimidine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-butan-2-yloxy-6-chloro-2-methylpyrimidine (CAS 1249047-50-4) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 4-butan-2-yloxy-6-chloro-2-methylpyrimidine. InChIKey: RNJQNJGTUUSIIQ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 4-butan-2-yloxy-6-chloro-2-methylpyrimidine |
| InChIKey | RNJQNJGTUUSIIQ-UHFFFAOYSA-N |
| SMILES | CCC(C)OC1=CC(=NC(=N1)C)Cl |
Computed by PubChem (NCBI)