Products 1249125-02-7
CAS 1249125-02-7 is the registry number for 2-(3-Cyano-1H-1,2,4-triazol-1-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid (CAS 1249125-02-7) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid. InChIKey: AGMJUQOUQIJLIL-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-(3-cyano-1,2,4-triazol-1-yl)butanoic acid |
| InChIKey | AGMJUQOUQIJLIL-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)N1C=NC(=N1)C#N |
Computed by PubChem (NCBI)