CAS 1249162-37-5 appears in our catalog under these names: 4-(2-(1-Aminoethyl)-1,3-thiazol-4-yl)benzonitrile, 95%, 4-(2-(1-Aminoethyl)-1,3-thiazol-4-yl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-[2-(1-aminoethyl)-1,3-thiazol-4-yl]benzonitrile (CAS 1249162-37-5) is a chemical compound with the molecular formula C12H11N3S and a molecular weight of 229.30 g/mol. IUPAC name: 4-[2-(1-aminoethyl)-1,3-thiazol-4-yl]benzonitrile. InChIKey: VFIFVTFLNDXWMW-UHFFFAOYSA-N.
| Molecular formula | C12H11N3S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 4-[2-(1-aminoethyl)-1,3-thiazol-4-yl]benzonitrile |
| InChIKey | VFIFVTFLNDXWMW-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=CS1)C2=CC=C(C=C2)C#N)N |
Computed by PubChem (NCBI)