Products 2778162-15-3
CAS 2778162-15-3 is the registry number for TTR stabilizer 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole (CAS 2778162-15-3) is a chemical compound with the molecular formula C12H11N3S and a molecular weight of 229.30 g/mol. IUPAC name: 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole. InChIKey: YFMRWZLTMDNCMD-UHFFFAOYSA-N.
| Molecular formula | C12H11N3S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole |
| InChIKey | YFMRWZLTMDNCMD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=C3C(=CC=C2)SC=N3 |
Computed by PubChem (NCBI)