CAS 864422-25-3 is the registry number for N-(Thiophen-2-ylmethyl)-1H-indazol-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(thiophen-2-ylmethyl)-1H-indazol-5-amine (CAS 864422-25-3) is a chemical compound with the molecular formula C12H11N3S and a molecular weight of 229.30 g/mol. IUPAC name: N-(thiophen-2-ylmethyl)-1H-indazol-5-amine. InChIKey: QSQVTOQGFILKMN-UHFFFAOYSA-N.
| Molecular formula | C12H11N3S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | N-(thiophen-2-ylmethyl)-1H-indazol-5-amine |
| InChIKey | QSQVTOQGFILKMN-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CNC2=CC3=C(C=C2)NN=C3 |
Computed by PubChem (NCBI)