CAS 1823827-77-5 is the registry number for 3H-Phenothiazine-3,7-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3H-phenothiazine-3,7-diamine (CAS 1823827-77-5) is a chemical compound with the molecular formula C12H11N3S and a molecular weight of 229.30 g/mol. IUPAC name: 3H-phenothiazine-3,7-diamine. InChIKey: XHERJWTTXZCIDZ-UHFFFAOYSA-N.
| Molecular formula | C12H11N3S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 3H-phenothiazine-3,7-diamine |
| InChIKey | XHERJWTTXZCIDZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC3=C(C=C(C=C3)N)SC2=CC1N |
Computed by PubChem (NCBI)