CAS 851721-87-4 is the registry number for 7-Methyl-2-(thiophen-2-yl)imidazo(1,2-a)pyridin-3-amine, 95%. Offered by: AmBeed. Available pack sizes: 10g.
7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine (CAS 851721-87-4) is a chemical compound with the molecular formula C12H11N3S and a molecular weight of 229.30 g/mol. IUPAC name: 7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine. InChIKey: RWCXUFFPULHMEE-UHFFFAOYSA-N.
| Molecular formula | C12H11N3S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | RWCXUFFPULHMEE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=C(N2C=C1)N)C3=CC=CS3 |
Computed by PubChem (NCBI)