Products 612503-08-9

CAS 612503-08-9 is the registry number for 4-Amino-2-methyl-10h-thieno(2,3-b)(1,5)-benzodiazepine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine (CAS 612503-08-9) is a chemical compound with the molecular formula C12H11N3S and a molecular weight of 229.30 g/mol. IUPAC name: 2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine. InChIKey: ZTTWQKYKGNLCCA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3S
Molecular weight229.30 g/mol
IUPAC name2-methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine
InChIKeyZTTWQKYKGNLCCA-UHFFFAOYSA-N
SMILESCC1=CC2=C(S1)NC3=CC=CC=C3N=C2N

Computed by PubChem (NCBI)