CAS 1249337-80-1 is the registry number for 6-(1-Chloroethyl)-1,4-dihydroquinoxaline-2,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(1-chloroethyl)-1,4-dihydroquinoxaline-2,3-dione (CAS 1249337-80-1) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 6-(1-chloroethyl)-1,4-dihydroquinoxaline-2,3-dione. InChIKey: OCVFPKPUTOKQBW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 6-(1-chloroethyl)-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | OCVFPKPUTOKQBW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)NC(=O)C(=O)N2)Cl |
Computed by PubChem (NCBI)