CAS 1249410-88-5 appears in our catalog under these names: 2-[1-(2-Fluorophenyl)-1h-1,2,3-triazol-4-yl]ethan-1-ol, 95%, 2-(1-(2-Fluorophenyl)-1H-1,2,3-triazol-4-yl)ethan-1-ol, 95%, 2-(1-(2-Fluorophenyl)-1H-1,2,3-triazol-4-yl)ethan-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g.
2-[1-(2-fluorophenyl)triazol-4-yl]ethanol (CAS 1249410-88-5) is a chemical compound with the molecular formula C10H10FN3O and a molecular weight of 207.20 g/mol. IUPAC name: 2-[1-(2-fluorophenyl)triazol-4-yl]ethanol. InChIKey: ZNEDKFKQFAUWFL-UHFFFAOYSA-N.
| Molecular formula | C10H10FN3O |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 2-[1-(2-fluorophenyl)triazol-4-yl]ethanol |
| InChIKey | ZNEDKFKQFAUWFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(N=N2)CCO)F |
Computed by PubChem (NCBI)