CAS 1250228-33-1 appears in our catalog under these names: (1-(3-Fluoro-4-methylphenyl)-1H-1,2,3-triazol-4-yl)methanol, 97%, (1-(3-Fluoro-4-methylphenyl)-1H-1,2,3-triazol-4-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
[1-(3-fluoro-4-methylphenyl)triazol-4-yl]methanol (CAS 1250228-33-1) is a chemical compound with the molecular formula C10H10FN3O and a molecular weight of 207.20 g/mol. IUPAC name: [1-(3-fluoro-4-methylphenyl)triazol-4-yl]methanol. InChIKey: OSKUDTIOPBAFPZ-UHFFFAOYSA-N.
| Molecular formula | C10H10FN3O |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | [1-(3-fluoro-4-methylphenyl)triazol-4-yl]methanol |
| InChIKey | OSKUDTIOPBAFPZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C=C(N=N2)CO)F |
Computed by PubChem (NCBI)