CAS 136380-10-4 appears in our catalog under these names: (1–(4–fluorophenyl)–4–methyl–1H–1,2,3–triazol–5–yl)methanol, (1-(4-Fluorophenyl)-4-methyl-1h-1,2,3-triazol-5-yl)methanol, 95%, (1-(4-Fluorophenyl)-4-methyl-1H-1,2,3-triazol-5-yl)methanol, 97%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
[3-(4-fluorophenyl)-5-methyltriazol-4-yl]methanol (CAS 136380-10-4) is a chemical compound with the molecular formula C10H10FN3O and a molecular weight of 207.20 g/mol. IUPAC name: [3-(4-fluorophenyl)-5-methyltriazol-4-yl]methanol. InChIKey: PAPVCDWYFVTHQZ-UHFFFAOYSA-N.
| Molecular formula | C10H10FN3O |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | [3-(4-fluorophenyl)-5-methyltriazol-4-yl]methanol |
| InChIKey | PAPVCDWYFVTHQZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=N1)C2=CC=C(C=C2)F)CO |
Computed by PubChem (NCBI)