CAS 2410619-05-3 is the registry number for 1-(6-(4-Fluoro-1H-pyrazol-1-yl)pyridin-3-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethanol (CAS 2410619-05-3) is a chemical compound with the molecular formula C10H10FN3O and a molecular weight of 207.20 g/mol. IUPAC name: 1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethanol. InChIKey: RMDHCUUWUPLLIA-UHFFFAOYSA-N.
| Molecular formula | C10H10FN3O |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethanol |
| InChIKey | RMDHCUUWUPLLIA-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=C(C=C1)N2C=C(C=N2)F)O |
Computed by PubChem (NCBI)