CAS 1338949-33-9 is the registry number for (1-(4-Fluoro-3-methylphenyl)-1H-1,2,3-triazol-4-yl)methanol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[1-(4-fluoro-3-methylphenyl)triazol-4-yl]methanol (CAS 1338949-33-9) is a chemical compound with the molecular formula C10H10FN3O and a molecular weight of 207.20 g/mol. IUPAC name: [1-(4-fluoro-3-methylphenyl)triazol-4-yl]methanol. InChIKey: RWLVWJMNRRWYSX-UHFFFAOYSA-N.
| Molecular formula | C10H10FN3O |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | [1-(4-fluoro-3-methylphenyl)triazol-4-yl]methanol |
| InChIKey | RWLVWJMNRRWYSX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C=C(N=N2)CO)F |
Computed by PubChem (NCBI)