CAS 952183-23-2 is the registry number for [1-(3-Fluorobenzyl)-1h-1,2,3-triazol-4-yl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[1-[(3-fluorophenyl)methyl]triazol-4-yl]methanol (CAS 952183-23-2) is a chemical compound with the molecular formula C10H10FN3O and a molecular weight of 207.20 g/mol. IUPAC name: [1-[(3-fluorophenyl)methyl]triazol-4-yl]methanol. InChIKey: ZNHGZPQNCDVONF-UHFFFAOYSA-N.
| Molecular formula | C10H10FN3O |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | [1-[(3-fluorophenyl)methyl]triazol-4-yl]methanol |
| InChIKey | ZNHGZPQNCDVONF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CN2C=C(N=N2)CO |
Computed by PubChem (NCBI)