Products 1249542-49-1

CAS 1249542-49-1 is the registry number for 3-(Cyclopentyloxy)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-cyclopentyloxypyridine-2-carboxylic acid (CAS 1249542-49-1) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 3-cyclopentyloxypyridine-2-carboxylic acid. InChIKey: VGKKACFREAXRGB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO3
Molecular weight207.23 g/mol
IUPAC name3-cyclopentyloxypyridine-2-carboxylic acid
InChIKeyVGKKACFREAXRGB-UHFFFAOYSA-N
SMILESC1CCC(C1)OC2=C(N=CC=C2)C(=O)O

Computed by PubChem (NCBI)