Products 1249597-20-3
CAS 1249597-20-3 is the registry number for 3-(2-Hydroxyethoxy)-4-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-hydroxyethoxy)-4-nitrobenzoic acid (CAS 1249597-20-3) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: 3-(2-hydroxyethoxy)-4-nitrobenzoic acid. InChIKey: APGOBMZJQQMSBQ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 3-(2-hydroxyethoxy)-4-nitrobenzoic acid |
| InChIKey | APGOBMZJQQMSBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)OCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
3-(2-hydroxyethoxy)-4-nitrobenzoic acid