CAS 1249622-16-9 is the registry number for Methyl 2-amino-4-(1-methyl-1H-pyrazol-4-yl)thiophene-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl 2-amino-4-(1-methylpyrazol-4-yl)thiophene-3-carboxylate (CAS 1249622-16-9) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: methyl 2-amino-4-(1-methylpyrazol-4-yl)thiophene-3-carboxylate. InChIKey: FZELJNDPDDNWEW-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | methyl 2-amino-4-(1-methylpyrazol-4-yl)thiophene-3-carboxylate |
| InChIKey | FZELJNDPDDNWEW-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CSC(=C2C(=O)OC)N |
Computed by PubChem (NCBI)