Products 1250031-21-0
CAS 1250031-21-0 is the registry number for 2,5-Dichloro-α-cyclopropylbenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-(2,5-dichlorophenyl)methanol (CAS 1250031-21-0) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: cyclopropyl-(2,5-dichlorophenyl)methanol. InChIKey: NDGUCBXEMOCVGR-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | cyclopropyl-(2,5-dichlorophenyl)methanol |
| InChIKey | NDGUCBXEMOCVGR-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)