Products 54300-25-3
CAS 54300-25-3 appears in our catalog under these names: Cyclo(-Ala-His), Cyclo(–Ala–His), (3S,6S)-3-((1H-Imidazol-4-yl)methyl)-6-methylpiperazine-2,5-dione, 98%, 98%. Offered by: Creative Peptides, GLPBio, Chemat. Available pack sizes: on request, 1g, 250mg, 100mg.
(3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-methylpiperazine-2,5-dione (CAS 54300-25-3) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: (3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-methylpiperazine-2,5-dione. InChIKey: KWWFDFUTSPWSFY-FSPLSTOPSA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | (3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-methylpiperazine-2,5-dione |
| InChIKey | KWWFDFUTSPWSFY-FSPLSTOPSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)CC2=CN=CN2 |
Computed by PubChem (NCBI)