CAS 832-66-6 appears in our catalog under these names: 1,3,7,8-Tetramethylpurine-2,6-dione, 1,3,7,8-Tetramethylxanthine, 95+%, 95+%, 1,3,7,8-Tetramethylxanthine, 95+%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5000mg, 2000mg, 10000mg, 250mg.
1,3,7,8-tetramethylpurine-2,6-dione (CAS 832-66-6) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: 1,3,7,8-tetramethylpurine-2,6-dione. InChIKey: LFHHOHMIVKIHMG-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 1,3,7,8-tetramethylpurine-2,6-dione |
| InChIKey | LFHHOHMIVKIHMG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C(=O)N(C(=O)N2C)C |
Computed by PubChem (NCBI)