CAS 1250130-41-6 is the registry number for 3-(2,2,2-Trifluoroethoxy)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CAS 1250130-41-6) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid. InChIKey: ZYVCUJPSTZGVCU-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| InChIKey | ZYVCUJPSTZGVCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)