CAS 1250142-90-5 is the registry number for 3-(4-Chlorophenyl)-5,6,7,8-tetrahydro-(1,2,4)triazolo(4,3-a)pyrazine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (CAS 1250142-90-5) is a chemical compound with the molecular formula C11H11ClN4 and a molecular weight of 234.68 g/mol. IUPAC name: 3-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine. InChIKey: YZFSAVBEAKTNOO-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| InChIKey | YZFSAVBEAKTNOO-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NN=C2C3=CC=C(C=C3)Cl)CN1 |
Computed by PubChem (NCBI)