CAS 1250150-08-3 appears in our catalog under these names: 2',3'-Dihydrospiro(cyclopropane-1,1'-indene)-3-carboxylic acid, 2',3'-Dihydrospiro(cyclopropane-1,1'-indene)-3-carboxylic acid, 97%, 2',3'-Dihydrospiro[cyclopropane-1,1'-indene]-3-carboxylic acid, 97%, 97%, 2',3'-Dihydrospiro[cyclopropane-1,1'-indene]-2-carboxylic acid, 97%. Offered by: Biosynth, AmBeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 5g, 1g, 10g, 100mg, 250mg, 500mg.
Spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid (CAS 1250150-08-3) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid. InChIKey: UVOIDJPTVVIJKT-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid |
| InChIKey | UVOIDJPTVVIJKT-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2C(=O)O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)