CAS 1250201-47-8 is the registry number for 4-(3,4-Dichlorophenyl)-1,3-oxazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3,4-dichlorophenyl)-1,3-oxazol-2-amine (CAS 1250201-47-8) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-1,3-oxazol-2-amine. InChIKey: CSEAFEREKSEPIV-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-1,3-oxazol-2-amine |
| InChIKey | CSEAFEREKSEPIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=COC(=N2)N)Cl)Cl |
Computed by PubChem (NCBI)