Products 1250510-22-5
CAS 1250510-22-5 appears in our catalog under these names: 1–(3，5–difluorophenyl)cyclopropane–1–carboxylic acid, 1-(3,5-Difluorophenyl)cyclopropane-1-carboxylic acid, 1-(3,5-Difluorophenyl)cyclopropane-1-carboxylic acid, 90%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
1-(3,5-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 1250510-22-5) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 1-(3,5-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: RTIJVNQRFGUGMW-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | RTIJVNQRFGUGMW-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)