CAS 1250515-32-2 appears in our catalog under these names: 4-Fluoro-3-(1H-1,2,4-triazol-3-yl)aniline, 95%, 4-Fluoro-3-(1H-1,2,4-triazol-3-yl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-fluoro-3-(1H-1,2,4-triazol-5-yl)aniline (CAS 1250515-32-2) is a chemical compound with the molecular formula C8H7FN4 and a molecular weight of 178.17 g/mol. IUPAC name: 4-fluoro-3-(1H-1,2,4-triazol-5-yl)aniline. InChIKey: ADMKFTXMJOONOP-UHFFFAOYSA-N.
| Molecular formula | C8H7FN4 |
|---|---|
| Molecular weight | 178.17 g/mol |
| IUPAC name | 4-fluoro-3-(1H-1,2,4-triazol-5-yl)aniline |
| InChIKey | ADMKFTXMJOONOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C2=NC=NN2)F |
Computed by PubChem (NCBI)