CAS 1250904-40-5 appears in our catalog under these names: (2-(2,4-Dichlorophenyl)phenyl)methanamine, 95%, (2-(2,4-Dichlorophenyl)phenyl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[2-(2,4-dichlorophenyl)phenyl]methanamine (CAS 1250904-40-5) is a chemical compound with the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. IUPAC name: [2-(2,4-dichlorophenyl)phenyl]methanamine. InChIKey: NUOPVWPBGUZVPG-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | [2-(2,4-dichlorophenyl)phenyl]methanamine |
| InChIKey | NUOPVWPBGUZVPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)