CAS 58597-10-7 appears in our catalog under these names: 2,6-Dichloro-3-(4-methylbenzyl)pyridine, 95%, 2,6-Dichloro-3-(4-methylbenzyl)pyridine, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,6-dichloro-3-[(4-methylphenyl)methyl]pyridine (CAS 58597-10-7) is a chemical compound with the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. IUPAC name: 2,6-dichloro-3-[(4-methylphenyl)methyl]pyridine. InChIKey: YDHICZWWWIQJAC-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | 2,6-dichloro-3-[(4-methylphenyl)methyl]pyridine |
| InChIKey | YDHICZWWWIQJAC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=C(N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)